C22H24N2O2 — CID 159705780
methane;2-(4-methylanilino)-3-pyrrolidin-1-ylnaphthalene-1,4-dione (PubChem CID 159705780) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is methane;2-(4-methylanilino)-3-pyrrolidin-1-ylnaphthalene-1,4-dione.
| Compound Name | methane;2-(4-methylanilino)-3-pyrrolidin-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 159705780 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | methane;2-(4-methylanilino)-3-pyrrolidin-1-ylnaphthalene-1,4-dione |
| SMILES | C.Cc1ccc(NC2=C(N3CCCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C21H20N2O2.CH4/c1-14-8-10-15(11-9-14)22-18-19(23-12-4-5-13-23)21(25)17-7-3-2-6-16(17)20(18)24;/h2-3,6-11,22H,4-5,12-13H2,1H3;1H4 |
| InChIKey | MYENYQJJVADKCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|