C22H22N2O2 — CID 2833933
2-(4-methylanilino)-3-piperidin-1-ylnaphthalene-1,4-dione (PubChem CID 2833933) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-(4-methylanilino)-3-piperidin-1-ylnaphthalene-1,4-dione.
| Compound Name | 2-(4-methylanilino)-3-piperidin-1-ylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 2833933 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-(4-methylanilino)-3-piperidin-1-ylnaphthalene-1,4-dione |
| SMILES | Cc1ccc(NC2=C(N3CCCCC3)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H22N2O2/c1-15-9-11-16(12-10-15)23-19-20(24-13-5-2-6-14-24)22(26)18-8-4-3-7-17(18)21(19)25/h3-4,7-12,23H,2,5-6,13-14H2,1H3 |
| InChIKey | SRBBCQOOXRLZOZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|