About N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide
N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide (PubChem CID 46500538) has the molecular formula C25H26N2O3
and a molecular weight of 402.49 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide |
| PubChem CID | 46500538 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide |
| SMILES | CC(=O)N(C1=C(N2CCCCC2)C(=O)c2ccccc2C1=O)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-16-13-17(2)15-19(14-16)27(18(3)28)23-22(26-11-7-4-8-12-26)24(29)20-9-5-6-10-21(20)25(23)30/h5-6,9-10,13-15H,4,7-8,11-12H2,1-3H3 |
| InChIKey | OLTJKTWHMCXBKL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide?
The IUPAC name of N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide (CID 46500538) is N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide.
What is the SMILES notation for N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide?
The canonical SMILES for N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide is CC(=O)N(C1=C(N2CCCCC2)C(=O)c2ccccc2C1=O)c1cc(C)cc(C)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide?
The InChIKey is OLTJKTWHMCXBKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O3/c1-16-13-17(2)15-19(14-16)27(18(3)28)23-22(26-11-7-4-8-12-26)24(29)20-9-5-6-10-21(20)25(23)30/h5-6,9-10,13-15H,4,7-8,11-12H2,1-3H3.
What are the key properties of N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide?
N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide has a molecular weight of 402.49 g/mol, XLogP of 4.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-N-(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)acetamide is sourced from PubChem (CID 46500538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).