C23H22N2O4 — CID 2903159
N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide (PubChem CID 2903159) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide.
| Compound Name | N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 2903159 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-(1,4-dioxo-3-pyrrolidin-1-ylnaphthalen-2-yl)-N-(3-methoxyphenyl)acetamide |
| SMILES | COc1cccc(N(C(C)=O)C2=C(N3CCCC3)C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C23H22N2O4/c1-15(26)25(16-8-7-9-17(14-16)29-2)21-20(24-12-5-6-13-24)22(27)18-10-3-4-11-19(18)23(21)28/h3-4,7-11,14H,5-6,12-13H2,1-2H3 |
| InChIKey | QFZUDYQQHNIWOZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|