C23H22N2O4 — CID 4245334
methyl 2-[(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)amino]benzoate (PubChem CID 4245334) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is methyl 2-[(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)amino]benzoate.
| Compound Name | methyl 2-[(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 4245334 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | methyl 2-[(1,4-dioxo-3-piperidin-1-ylnaphthalen-2-yl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC1=C(N2CCCCC2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H22N2O4/c1-29-23(28)17-11-5-6-12-18(17)24-19-20(25-13-7-2-8-14-25)22(27)16-10-4-3-9-15(16)21(19)26/h3-6,9-12,24H,2,7-8,13-14H2,1H3 |
| InChIKey | SXNQROKZNVRQMQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|