C16H16N2O4S — CID 75489245
methyl 2-[(3,4-dioxo-2-thiomorpholin-4-ylcyclobuten-1-yl)amino]benzoate (PubChem CID 75489245) has the molecular formula C16H16N2O4S and a molecular weight of 332.38 g/mol. Its IUPAC name is methyl 2-[(3,4-dioxo-2-thiomorpholin-4-ylcyclobuten-1-yl)amino]benzoate.
| Compound Name | methyl 2-[(3,4-dioxo-2-thiomorpholin-4-ylcyclobuten-1-yl)amino]benzoate |
|---|---|
| PubChem CID | 75489245 |
| Molecular Formula | C16H16N2O4S |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | methyl 2-[(3,4-dioxo-2-thiomorpholin-4-ylcyclobuten-1-yl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1c(N2CCSCC2)c(=O)c1=O |
| InChI | InChI=1S/C16H16N2O4S/c1-22-16(21)10-4-2-3-5-11(10)17-12-13(15(20)14(12)19)18-6-8-23-9-7-18/h2-5,17H,6-9H2,1H3 |
| InChIKey | JOESXIYJHXPTPM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|