C21H32N10O2 — CID 58865182
methyl 2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate (PubChem CID 58865182) has the molecular formula C21H32N10O2 and a molecular weight of 456.56 g/mol. Its IUPAC name is methyl 2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate.
| Compound Name | methyl 2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 58865182 |
| Molecular Formula | C21H32N10O2 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | methyl 2-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1nc(N2C[C@H](N)C[C@H](N)C2)nc(N2C[C@H](N)C[C@H](N)C2)n1 |
| InChI | InChI=1S/C21H32N10O2/c1-33-18(32)16-4-2-3-5-17(16)26-19-27-20(30-8-12(22)6-13(23)9-30)29-21(28-19)31-10-14(24)7-15(25)11-31/h2-5,12-15H,6-11,22-25H2,1H3,(H,26,27,28,29)/t12-,13+,14-,15+ |
| InChIKey | ANGVKEPRRPUGDQ-NMWPEEMBSA-N |
| XLogP | -0.87 |
| TPSA | 187.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |