C20H27ClN6O4 — CID 44899506
ethyl 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate;hydrochloride (PubChem CID 44899506) has the molecular formula C20H27ClN6O4 and a molecular weight of 450.93 g/mol. Its IUPAC name is ethyl 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate;hydrochloride.
| Compound Name | ethyl 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate;hydrochloride |
|---|---|
| PubChem CID | 44899506 |
| Molecular Formula | C20H27ClN6O4 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | ethyl 2-[(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)amino]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccccc1Nc1nc(N2CCOCC2)nc(N2CCOCC2)n1.Cl |
| InChI | InChI=1S/C20H26N6O4.ClH/c1-2-30-17(27)15-5-3-4-6-16(15)21-18-22-19(25-7-11-28-12-8-25)24-20(23-18)26-9-13-29-14-10-26;/h3-6H,2,7-14H2,1H3,(H,21,22,23,24);1H |
| InChIKey | HEXIMKLVJLVWON-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 101.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |