C26H24N4O2 — CID 58090757
ethyl 2-[(4,6-dibenzyl-1,3,5-triazin-2-yl)amino]benzoate (PubChem CID 58090757) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is ethyl 2-[(4,6-dibenzyl-1,3,5-triazin-2-yl)amino]benzoate.
| Compound Name | ethyl 2-[(4,6-dibenzyl-1,3,5-triazin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 58090757 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | ethyl 2-[(4,6-dibenzyl-1,3,5-triazin-2-yl)amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1nc(Cc2ccccc2)nc(Cc2ccccc2)n1 |
| InChI | InChI=1S/C26H24N4O2/c1-2-32-25(31)21-15-9-10-16-22(21)27-26-29-23(17-19-11-5-3-6-12-19)28-24(30-26)18-20-13-7-4-8-14-20/h3-16H,2,17-18H2,1H3,(H,27,28,29,30) |
| InChIKey | KCNFCFNWSSAVGI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |