C26H32N10O — CID 58949073
3-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]fluoren-9-one (PubChem CID 58949073) has the molecular formula C26H32N10O and a molecular weight of 500.61 g/mol. Its IUPAC name is 3-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]fluoren-9-one.
| Compound Name | 3-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]fluoren-9-one |
|---|---|
| PubChem CID | 58949073 |
| Molecular Formula | C26H32N10O |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 3-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]fluoren-9-one |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc4c(c3)-c3ccccc3C4=O)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H32N10O/c27-14-7-15(28)11-35(10-14)25-32-24(33-26(34-25)36-12-16(29)8-17(30)13-36)31-18-5-6-21-22(9-18)19-3-1-2-4-20(19)23(21)37/h1-6,9,14-17H,7-8,10-13,27-30H2,(H,31,32,33,34)/t14-,15+,16-,17+ |
| InChIKey | NXQHYYZFCXIPQY-WNKDZCFJSA-N |
| XLogP | 0.56 |
| TPSA | 178.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |