C26H37N11O — CID 21104166
1-[4-(4-amino-3-phenylmethoxyanilino)-6-(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 21104166) has the molecular formula C26H37N11O and a molecular weight of 519.66 g/mol. Its IUPAC name is 1-[4-(4-amino-3-phenylmethoxyanilino)-6-(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | 1-[4-(4-amino-3-phenylmethoxyanilino)-6-(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 21104166 |
| Molecular Formula | C26H37N11O |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | 1-[4-(4-amino-3-phenylmethoxyanilino)-6-(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | Nc1ccc(Nc2nc(N3CC(N)CC(N)C3)nc(N3CC(N)CC(N)C3)n2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C26H37N11O/c27-17-8-18(28)12-36(11-17)25-33-24(34-26(35-25)37-13-19(29)9-20(30)14-37)32-21-6-7-22(31)23(10-21)38-15-16-4-2-1-3-5-16/h1-7,10,17-20H,8-9,11-15,27-31H2,(H,32,33,34,35) |
| InChIKey | RBYNIXSVRGJVFU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 196.51 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|