C14H18Cl2N8 — CID 58948938
6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 58948938) has the molecular formula C14H18Cl2N8 and a molecular weight of 369.26 g/mol. Its IUPAC name is 6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58948938 |
| Molecular Formula | C14H18Cl2N8 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-2-N-(3,4-dichlorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccc(Cl)c(Cl)c2)nc(N2C[C@H](N)C[C@H](N)C2)n1 |
| InChI | InChI=1S/C14H18Cl2N8/c15-10-2-1-9(4-11(10)16)20-13-21-12(19)22-14(23-13)24-5-7(17)3-8(18)6-24/h1-2,4,7-8H,3,5-6,17-18H2,(H3,19,20,21,22,23)/t7-,8+ |
| InChIKey | SZCRFYRJSJRWQD-OCAPTIKFSA-N |
| XLogP | 1.37 |
| TPSA | 132.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |