C19H28ClN11O2 — CID 58949227
(3R,5S)-1-[4-(3-chloro-4-nitroanilino)-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine (PubChem CID 58949227) has the molecular formula C19H28ClN11O2 and a molecular weight of 477.96 g/mol. Its IUPAC name is (3R,5S)-1-[4-(3-chloro-4-nitroanilino)-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine.
| Compound Name | (3R,5S)-1-[4-(3-chloro-4-nitroanilino)-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
|---|---|
| PubChem CID | 58949227 |
| Molecular Formula | C19H28ClN11O2 |
| Molecular Weight | 477.96 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | (3R,5S)-1-[4-(3-chloro-4-nitroanilino)-6-[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]piperidine-3,5-diamine |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc([N+](=O)[O-])c(Cl)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C19H28ClN11O2/c20-15-5-14(1-2-16(15)31(32)33)25-17-26-18(29-6-10(21)3-11(22)7-29)28-19(27-17)30-8-12(23)4-13(24)9-30/h1-2,5,10-13H,3-4,6-9,21-24H2,(H,25,26,27,28)/t10-,11+,12-,13+ |
| InChIKey | DJQOPGMKNYZPRH-MPZDIEGVSA-N |
| XLogP | -0.09 |
| TPSA | 204.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.96 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|