C26H34ClN11O3 — CID 58948877
N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloro-2-hydroxybenzamide (PubChem CID 58948877) has the molecular formula C26H34ClN11O3 and a molecular weight of 584.09 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloro-2-hydroxybenzamide.
| Compound Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 58948877 |
| Molecular Formula | C26H34ClN11O3 |
| Molecular Weight | 584.09 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-3-chloro-2-hydroxybenzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4cccc(Cl)c4O)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H34ClN11O3/c27-19-3-1-2-18(22(19)40)23(41)33-20-5-4-17(8-21(20)39)32-24-34-25(37-9-13(28)6-14(29)10-37)36-26(35-24)38-11-15(30)7-16(31)12-38/h1-5,8,13-16,39-40H,6-7,9-12,28-31H2,(H,33,41)(H,32,34,35,36)/t13-,14+,15-,16+ |
| InChIKey | WNJMAVISJDQGKO-GEEKYZPCSA-N |
| XLogP | 0.66 |
| TPSA | 230.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.09 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|