C25H33ClN12O3 — CID 24857898
N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-chloro-2-oxo-1H-pyridine-3-carboxamide (PubChem CID 24857898) has the molecular formula C25H33ClN12O3 and a molecular weight of 585.07 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-chloro-2-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-chloro-2-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 24857898 |
| Molecular Formula | C25H33ClN12O3 |
| Molecular Weight | 585.07 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | N-[4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-chloro-2-oxo-1H-pyridine-3-carboxamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4cc(Cl)c[nH]c4=O)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C25H33ClN12O3/c26-12-3-18(21(40)31-7-12)22(41)33-19-2-1-17(6-20(19)39)32-23-34-24(37-8-13(27)4-14(28)9-37)36-25(35-23)38-10-15(29)5-16(30)11-38/h1-3,6-7,13-16,39H,4-5,8-11,27-30H2,(H,31,40)(H,33,41)(H,32,34,35,36)/t13-,14+,15-,16+ |
| InChIKey | HITYNAMGKQYZHZ-GEEKYZPCSA-N |
| XLogP | -0.36 |
| TPSA | 243.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.07 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|