C23H28N8O3 — CID 21104094
N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide (PubChem CID 21104094) has the molecular formula C23H28N8O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide.
| Compound Name | N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 21104094 |
| Molecular Formula | C23H28N8O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-methoxy-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide |
| SMILES | COc1nc(Nc2ccc(NC(=O)c3ccc(C)cc3)c(O)c2)nc(N2C[C@H](N)C[C@H](N)C2)n1 |
| InChI | InChI=1S/C23H28N8O3/c1-13-3-5-14(6-4-13)20(33)27-18-8-7-17(10-19(18)32)26-21-28-22(30-23(29-21)34-2)31-11-15(24)9-16(25)12-31/h3-8,10,15-16,32H,9,11-12,24-25H2,1-2H3,(H,27,33)(H,26,28,29,30)/t15-,16+ |
| InChIKey | ITQBABGZJFIXRX-IYBDPMFKSA-N |
| XLogP | 1.75 |
| TPSA | 164.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|