C28H34N6O2 — CID 58865669
N-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]-2-hydroxyphenyl]-4-methylbenzamide (PubChem CID 58865669) has the molecular formula C28H34N6O2 and a molecular weight of 486.62 g/mol. Its IUPAC name is N-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]-2-hydroxyphenyl]-4-methylbenzamide.
| Compound Name | N-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]-2-hydroxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58865669 |
| Molecular Formula | C28H34N6O2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | N-[4-[(4-cyclohexyl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]-2-hydroxyphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Nc3nc(C4CCCCC4)nc(N4CCCCC4)n3)cc2O)cc1 |
| InChI | InChI=1S/C28H34N6O2/c1-19-10-12-21(13-11-19)26(36)30-23-15-14-22(18-24(23)35)29-27-31-25(20-8-4-2-5-9-20)32-28(33-27)34-16-6-3-7-17-34/h10-15,18,20,35H,2-9,16-17H2,1H3,(H,30,36)(H,29,31,32,33) |
| InChIKey | KSQNXUZDZDGESP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|