C26H30BrN7O2 — CID 58865237
3-bromo-N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]benzamide (PubChem CID 58865237) has the molecular formula C26H30BrN7O2 and a molecular weight of 552.48 g/mol. Its IUPAC name is 3-bromo-N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]benzamide |
|---|---|
| PubChem CID | 58865237 |
| Molecular Formula | C26H30BrN7O2 |
| Molecular Weight | 552.48 g/mol |
| Exact Mass | 551.16 |
| IUPAC Name | 3-bromo-N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1O)c1cccc(Br)c1 |
| InChI | InChI=1S/C26H30BrN7O2/c27-19-9-7-8-18(16-19)23(36)29-21-11-10-20(17-22(21)35)28-24-30-25(33-12-3-1-4-13-33)32-26(31-24)34-14-5-2-6-15-34/h7-11,16-17,35H,1-6,12-15H2,(H,29,36)(H,28,30,31,32) |
| InChIKey | LSLCWIFYRRLTSV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|