C26H33Cl2N11O2 — CID 58948990
N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2,6-dichlorobenzamide (PubChem CID 58948990) has the molecular formula C26H33Cl2N11O2 and a molecular weight of 602.53 g/mol. Its IUPAC name is N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2,6-dichlorobenzamide.
| Compound Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 58948990 |
| Molecular Formula | C26H33Cl2N11O2 |
| Molecular Weight | 602.53 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | N-[4-[[4,6-bis[(3R,5S)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2,6-dichlorobenzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(NC(=O)c4c(Cl)cccc4Cl)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C26H33Cl2N11O2/c27-18-2-1-3-19(28)22(18)23(41)34-20-5-4-17(8-21(20)40)33-24-35-25(38-9-13(29)6-14(30)10-38)37-26(36-24)39-11-15(31)7-16(32)12-39/h1-5,8,13-16,40H,6-7,9-12,29-32H2,(H,34,41)(H,33,35,36,37)/t13-,14+,15-,16+ |
| InChIKey | XYASGTRIOZFZLK-GEEKYZPCSA-N |
| XLogP | 1.61 |
| TPSA | 210.59 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.53 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|