C27H35N9O3 — CID 58949120
N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide (PubChem CID 58949120) has the molecular formula C27H35N9O3 and a molecular weight of 533.64 g/mol. Its IUPAC name is N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide.
| Compound Name | N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 58949120 |
| Molecular Formula | C27H35N9O3 |
| Molecular Weight | 533.64 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | N-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(Nc3nc(N4C[C@H](N)C[C@H](N)C4)nc(N4CCC[C@@H](O)C4)n3)cc2O)cc1 |
| InChI | InChI=1S/C27H35N9O3/c1-16-4-6-17(7-5-16)24(39)31-22-9-8-20(12-23(22)38)30-25-32-26(35-10-2-3-21(37)15-35)34-27(33-25)36-13-18(28)11-19(29)14-36/h4-9,12,18-19,21,37-38H,2-3,10-11,13-15,28-29H2,1H3,(H,31,39)(H,30,32,33,34)/t18-,19+,21-/m1/s1 |
| InChIKey | DEARBTOPZJSJGH-SVFBPWRDSA-N |
| XLogP | 1.71 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.64 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|