C26H32N8O4 — CID 91162824
phenyl 4-[[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate (PubChem CID 91162824) has the molecular formula C26H32N8O4 and a molecular weight of 520.59 g/mol. Its IUPAC name is phenyl 4-[[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate.
| Compound Name | phenyl 4-[[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 91162824 |
| Molecular Formula | C26H32N8O4 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.25 |
| IUPAC Name | phenyl 4-[[4-[(3S,5R)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxybenzoate |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)Oc4ccccc4)c(O)c3)nc(N3CCC[C@@H](O)C3)n2)C1 |
| InChI | InChI=1S/C26H32N8O4/c27-16-11-17(28)14-34(13-16)26-31-24(30-25(32-26)33-10-4-5-19(35)15-33)29-18-8-9-21(22(36)12-18)23(37)38-20-6-2-1-3-7-20/h1-3,6-9,12,16-17,19,35-36H,4-5,10-11,13-15,27-28H2,(H,29,30,31,32)/t16-,17+,19-/m1/s1 |
| InChIKey | MMWDZHLCOROTMX-ZIFCJYIRSA-N |
| XLogP | 1.37 |
| TPSA | 175.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|