C28H34ClN9O3 — CID 58948951
N-(2-chlorophenyl)-3-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide (PubChem CID 58948951) has the molecular formula C28H34ClN9O3 and a molecular weight of 580.09 g/mol. Its IUPAC name is N-(2-chlorophenyl)-3-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide.
| Compound Name | N-(2-chlorophenyl)-3-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 58948951 |
| Molecular Formula | C28H34ClN9O3 |
| Molecular Weight | 580.09 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | N-(2-chlorophenyl)-3-[4-[[4-[(3R,5S)-3,5-diaminopiperidin-1-yl]-6-[(3R)-3-hydroxypiperidin-1-yl]-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)CC(=O)Nc4ccccc4Cl)cc3)nc(N3CCC[C@@H](O)C3)n2)C1 |
| InChI | InChI=1S/C28H34ClN9O3/c29-22-5-1-2-6-23(22)33-25(41)13-24(40)17-7-9-20(10-8-17)32-26-34-27(37-11-3-4-21(39)16-37)36-28(35-26)38-14-18(30)12-19(31)15-38/h1-2,5-10,18-19,21,39H,3-4,11-16,30-31H2,(H,33,41)(H,32,34,35,36)/t18-,19+,21-/m1/s1 |
| InChIKey | NEXSIQPLUWUXCP-SVFBPWRDSA-N |
| XLogP | 2.31 |
| TPSA | 175.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.09 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|