C28H31ClFN7O2 — CID 58865283
N-(4-chloro-2-fluorophenyl)-3-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide (PubChem CID 58865283) has the molecular formula C28H31ClFN7O2 and a molecular weight of 552.05 g/mol. Its IUPAC name is N-(4-chloro-2-fluorophenyl)-3-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide.
| Compound Name | N-(4-chloro-2-fluorophenyl)-3-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 58865283 |
| Molecular Formula | C28H31ClFN7O2 |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | N-(4-chloro-2-fluorophenyl)-3-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-3-oxopropanamide |
| SMILES | O=C(CC(=O)c1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C28H31ClFN7O2/c29-20-9-12-23(22(30)17-20)32-25(39)18-24(38)19-7-10-21(11-8-19)31-26-33-27(36-13-3-1-4-14-36)35-28(34-26)37-15-5-2-6-16-37/h7-12,17H,1-6,13-16,18H2,(H,32,39)(H,31,33,34,35) |
| InChIKey | KHHJXSYEZHAKCK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|