C26H30FN7O3 — CID 58865684
N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-fluoro-2-hydroxybenzamide (PubChem CID 58865684) has the molecular formula C26H30FN7O3 and a molecular weight of 507.57 g/mol. Its IUPAC name is N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 58865684 |
| Molecular Formula | C26H30FN7O3 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-5-fluoro-2-hydroxybenzamide |
| SMILES | O=C(Nc1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1O)c1cc(F)ccc1O |
| InChI | InChI=1S/C26H30FN7O3/c27-17-7-10-21(35)19(15-17)23(37)29-20-9-8-18(16-22(20)36)28-24-30-25(33-11-3-1-4-12-33)32-26(31-24)34-13-5-2-6-14-34/h7-10,15-16,35-36H,1-6,11-14H2,(H,29,37)(H,28,30,31,32) |
| InChIKey | FOMSGMCFAACSPG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|