C25H29ClN8O2 — CID 58865439
4-chloro-N-[2-hydroxy-4-[(4-piperazin-1-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]benzamide (PubChem CID 58865439) has the molecular formula C25H29ClN8O2 and a molecular weight of 509.01 g/mol. Its IUPAC name is 4-chloro-N-[2-hydroxy-4-[(4-piperazin-1-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]benzamide.
| Compound Name | 4-chloro-N-[2-hydroxy-4-[(4-piperazin-1-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 58865439 |
| Molecular Formula | C25H29ClN8O2 |
| Molecular Weight | 509.01 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 4-chloro-N-[2-hydroxy-4-[(4-piperazin-1-yl-6-piperidin-1-yl-1,3,5-triazin-2-yl)amino]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Nc2nc(N3CCCCC3)nc(N3CCNCC3)n2)cc1O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29ClN8O2/c26-18-6-4-17(5-7-18)22(36)29-20-9-8-19(16-21(20)35)28-23-30-24(33-12-2-1-3-13-33)32-25(31-23)34-14-10-27-11-15-34/h4-9,16,27,35H,1-3,10-15H2,(H,29,36)(H,28,30,31,32) |
| InChIKey | ONYNSENWFOMCHQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.01 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|