C28H35N7O5 — CID 58865719
N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-3,4-dimethoxybenzamide (PubChem CID 58865719) has the molecular formula C28H35N7O5 and a molecular weight of 549.63 g/mol. Its IUPAC name is N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 58865719 |
| Molecular Formula | C28H35N7O5 |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Nc3nc(N4CCCCC4)nc(N4CCCCC4)n3)cc2O)c(O)c1OC |
| InChI | InChI=1S/C28H35N7O5/c1-39-22-12-10-19(23(37)24(22)40-2)25(38)30-20-11-9-18(17-21(20)36)29-26-31-27(34-13-5-3-6-14-34)33-28(32-26)35-15-7-4-8-16-35/h9-12,17,36-37H,3-8,13-16H2,1-2H3,(H,30,38)(H,29,31,32,33) |
| InChIKey | ZZZWRWWXBDITAN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 145.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|