C27H30F3N7O4 — CID 58865870
N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-5-(trifluoromethoxy)benzamide (PubChem CID 58865870) has the molecular formula C27H30F3N7O4 and a molecular weight of 573.58 g/mol. Its IUPAC name is N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-5-(trifluoromethoxy)benzamide.
| Compound Name | N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-5-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 58865870 |
| Molecular Formula | C27H30F3N7O4 |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | N-[4-[[4,6-di(piperidin-1-yl)-1,3,5-triazin-2-yl]amino]-2-hydroxyphenyl]-2-hydroxy-5-(trifluoromethoxy)benzamide |
| SMILES | O=C(Nc1ccc(Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc1O)c1cc(OC(F)(F)F)ccc1O |
| InChI | InChI=1S/C27H30F3N7O4/c28-27(29,30)41-18-8-10-21(38)19(16-18)23(40)32-20-9-7-17(15-22(20)39)31-24-33-25(36-11-3-1-4-12-36)35-26(34-24)37-13-5-2-6-14-37/h7-10,15-16,38-39H,1-6,11-14H2,(H,32,40)(H,31,33,34,35) |
| InChIKey | FBMRSSPSUZVUMN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 135.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|