C27H34F3N11O3 — CID 11786871
4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-[3-(trifluoromethoxy)phenyl]benzamide (PubChem CID 11786871) has the molecular formula C27H34F3N11O3 and a molecular weight of 617.64 g/mol. Its IUPAC name is 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-[3-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-[3-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 11786871 |
| Molecular Formula | C27H34F3N11O3 |
| Molecular Weight | 617.64 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | 4-[[4,6-bis[(3S,5R)-3,5-diaminopiperidin-1-yl]-1,3,5-triazin-2-yl]amino]-2-hydroxy-N-[3-(trifluoromethoxy)phenyl]benzamide |
| SMILES | N[C@@H]1C[C@H](N)CN(c2nc(Nc3ccc(C(=O)Nc4cccc(OC(F)(F)F)c4)c(O)c3)nc(N3C[C@H](N)C[C@H](N)C3)n2)C1 |
| InChI | InChI=1S/C27H34F3N11O3/c28-27(29,30)44-20-3-1-2-18(8-20)35-23(43)21-5-4-19(9-22(21)42)36-24-37-25(40-10-14(31)6-15(32)11-40)39-26(38-24)41-12-16(33)7-17(34)13-41/h1-5,8-9,14-17,42H,6-7,10-13,31-34H2,(H,35,43)(H,36,37,38,39)/t14-,15+,16-,17+ |
| InChIKey | DYWYBUNWNTWYQN-WNKDZCFJSA-N |
| XLogP | 1.20 |
| TPSA | 219.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.64 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |