C13H16ClN7 — CID 80911509
N-(4-chlorophenyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80911509) has the molecular formula C13H16ClN7 and a molecular weight of 305.77 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(4-chlorophenyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80911509 |
| Molecular Formula | C13H16ClN7 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(4-chlorophenyl)-4-hydrazinyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | NNc1nc(Nc2ccc(Cl)cc2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H16ClN7/c14-9-3-5-10(6-4-9)16-11-17-12(20-15)19-13(18-11)21-7-1-2-8-21/h3-6H,1-2,7-8,15H2,(H2,16,17,18,19,20) |
| InChIKey | LPASLJORHWZEIV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|