C33H43N11O4 — CID 91530628
3-[4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-3-oxopropanamide (PubChem CID 91530628) has the molecular formula C33H43N11O4 and a molecular weight of 657.78 g/mol. Its IUPAC name is 3-[4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-3-oxopropanamide.
| Compound Name | 3-[4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 91530628 |
| Molecular Formula | C33H43N11O4 |
| Molecular Weight | 657.78 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | 3-[4-[[4,6-bis(3,5-diaminopiperidin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-[1-(1,3-dioxol-4-yl)-2-phenylethyl]-3-oxopropanamide |
| SMILES | NC1CC(N)CN(c2nc(Nc3ccc(C(=O)CC(=O)NC(Cc4ccccc4)C4=COCO4)cc3)nc(N3CC(N)CC(N)C3)n2)C1 |
| InChI | InChI=1S/C33H43N11O4/c34-22-11-23(35)15-43(14-22)32-40-31(41-33(42-32)44-16-24(36)12-25(37)17-44)38-26-8-6-21(7-9-26)28(45)13-30(46)39-27(29-18-47-19-48-29)10-20-4-2-1-3-5-20/h1-9,18,22-25,27H,10-17,19,34-37H2,(H,39,46)(H,38,40,41,42) |
| InChIKey | VVYLGOAPPVIULH-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 225.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.78 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|