C14H17BrN6 — CID 80736600
2-N-(3-bromophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 80736600) has the molecular formula C14H17BrN6 and a molecular weight of 349.24 g/mol. Its IUPAC name is 2-N-(3-bromophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(3-bromophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80736600 |
| Molecular Formula | C14H17BrN6 |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 2-N-(3-bromophenyl)-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2cccc(Br)c2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H17BrN6/c15-10-5-4-6-11(9-10)17-13-18-12(16)19-14(20-13)21-7-2-1-3-8-21/h4-6,9H,1-3,7-8H2,(H3,16,17,18,19,20) |
| InChIKey | BWMWMUDJNCWAMR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |