C13H13ClIN5 — CID 62870369
4-chloro-N-(3-iodophenyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 62870369) has the molecular formula C13H13ClIN5 and a molecular weight of 401.64 g/mol. Its IUPAC name is 4-chloro-N-(3-iodophenyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(3-iodophenyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 62870369 |
| Molecular Formula | C13H13ClIN5 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 400.99 |
| IUPAC Name | 4-chloro-N-(3-iodophenyl)-6-pyrrolidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Nc2cccc(I)c2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C13H13ClIN5/c14-11-17-12(16-10-5-3-4-9(15)8-10)19-13(18-11)20-6-1-2-7-20/h3-5,8H,1-2,6-7H2,(H,16,17,18,19) |
| InChIKey | BQSGISAKWHIJJY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|