C15H14ClIN4O — CID 55736428
5-chloro-N-(3-iodophenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 55736428) has the molecular formula C15H14ClIN4O and a molecular weight of 428.66 g/mol. Its IUPAC name is 5-chloro-N-(3-iodophenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(3-iodophenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 55736428 |
| Molecular Formula | C15H14ClIN4O |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 5-chloro-N-(3-iodophenyl)-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | O=C(Nc1cccc(I)c1)c1nc(N2CCCC2)ncc1Cl |
| InChI | InChI=1S/C15H14ClIN4O/c16-12-9-18-15(21-6-1-2-7-21)20-13(12)14(22)19-11-5-3-4-10(17)8-11/h3-5,8-9H,1-2,6-7H2,(H,19,22) |
| InChIKey | OTVVKWHCSBRRQZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|