C19H18ClN5O2 — CID 55949416
5-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 55949416) has the molecular formula C19H18ClN5O2 and a molecular weight of 383.84 g/mol. Its IUPAC name is 5-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 55949416 |
| Molecular Formula | C19H18ClN5O2 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 5-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)c2nc(N3CCCC3)ncc2Cl)c1 |
| InChI | InChI=1S/C19H18ClN5O2/c1-2-13-6-5-7-14(10-13)23-16(26)12-21-18(27)17-15(20)11-22-19(24-17)25-8-3-4-9-25/h1,5-7,10-11H,3-4,8-9,12H2,(H,21,27)(H,23,26) |
| InChIKey | PZSRGKVWGQLTJT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|