C22H20ClF3N4O2 — CID 55949151
1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-(3-ethynylanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 55949151) has the molecular formula C22H20ClF3N4O2 and a molecular weight of 464.88 g/mol. Its IUPAC name is 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-(3-ethynylanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-(3-ethynylanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55949151 |
| Molecular Formula | C22H20ClF3N4O2 |
| Molecular Weight | 464.88 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | 1-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-N-[2-(3-ethynylanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)C2CCN(c3ncc(C(F)(F)F)cc3Cl)CC2)c1 |
| InChI | InChI=1S/C22H20ClF3N4O2/c1-2-14-4-3-5-17(10-14)29-19(31)13-28-21(32)15-6-8-30(9-7-15)20-18(23)11-16(12-27-20)22(24,25)26/h1,3-5,10-12,15H,6-9,13H2,(H,28,32)(H,29,31) |
| InChIKey | HVUWVCUCRMPBHN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.88 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|