C21H17N5O4 — CID 55835510
1-cyclopropyl-N-[2-(3-ethynylanilino)-2-oxoethyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 55835510) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is 1-cyclopropyl-N-[2-(3-ethynylanilino)-2-oxoethyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 1-cyclopropyl-N-[2-(3-ethynylanilino)-2-oxoethyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 55835510 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-cyclopropyl-N-[2-(3-ethynylanilino)-2-oxoethyl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)c2cnc3c(c2)c(=O)[nH]c(=O)n3C2CC2)c1 |
| InChI | InChI=1S/C21H17N5O4/c1-2-12-4-3-5-14(8-12)24-17(27)11-23-19(28)13-9-16-18(22-10-13)26(15-6-7-15)21(30)25-20(16)29/h1,3-5,8-10,15H,6-7,11H2,(H,23,28)(H,24,27)(H,25,29,30) |
| InChIKey | YSRRDIDEWUYGKW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|