C16H23ClN4O2 — CID 111446102
5-chloro-N-[(1-hydroxycyclohexyl)methyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 111446102) has the molecular formula C16H23ClN4O2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 5-chloro-N-[(1-hydroxycyclohexyl)methyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[(1-hydroxycyclohexyl)methyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 111446102 |
| Molecular Formula | C16H23ClN4O2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 5-chloro-N-[(1-hydroxycyclohexyl)methyl]-2-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | O=C(NCC1(O)CCCCC1)c1nc(N2CCCC2)ncc1Cl |
| InChI | InChI=1S/C16H23ClN4O2/c17-12-10-18-15(21-8-4-5-9-21)20-13(12)14(22)19-11-16(23)6-2-1-3-7-16/h10,23H,1-9,11H2,(H,19,22) |
| InChIKey | YOMFHIFBKJCBER-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |