C11H14ClN3O2 — CID 111825049
5-chloro-N-[(1-hydroxycyclopentyl)methyl]pyrimidine-4-carboxamide (PubChem CID 111825049) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is 5-chloro-N-[(1-hydroxycyclopentyl)methyl]pyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[(1-hydroxycyclopentyl)methyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 111825049 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 5-chloro-N-[(1-hydroxycyclopentyl)methyl]pyrimidine-4-carboxamide |
| SMILES | O=C(NCC1(O)CCCC1)c1ncncc1Cl |
| InChI | InChI=1S/C11H14ClN3O2/c12-8-5-13-7-15-9(8)10(16)14-6-11(17)3-1-2-4-11/h5,7,17H,1-4,6H2,(H,14,16) |
| InChIKey | GGAMOKSDVAUHBF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |