C20H15ClN4O2 — CID 49328885
1-(2-chlorophenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]pyrazole-3-carboxamide (PubChem CID 49328885) has the molecular formula C20H15ClN4O2 and a molecular weight of 378.82 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]pyrazole-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 49328885 |
| Molecular Formula | C20H15ClN4O2 |
| Molecular Weight | 378.82 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-(2-chlorophenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]pyrazole-3-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)c2ccn(-c3ccccc3Cl)n2)c1 |
| InChI | InChI=1S/C20H15ClN4O2/c1-2-14-6-5-7-15(12-14)23-19(26)13-22-20(27)17-10-11-25(24-17)18-9-4-3-8-16(18)21/h1,3-12H,13H2,(H,22,27)(H,23,26) |
| InChIKey | MBJVZLWQUFTFQL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.82 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|