C22H21N5O2 — CID 55835887
2-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-5-methyltriazole-4-carboxamide (PubChem CID 55835887) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-5-methyltriazole-4-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-5-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 55835887 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-5-methyltriazole-4-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)c2nn(-c3ccc(C)cc3C)nc2C)c1 |
| InChI | InChI=1S/C22H21N5O2/c1-5-17-7-6-8-18(12-17)24-20(28)13-23-22(29)21-16(4)25-27(26-21)19-10-9-14(2)11-15(19)3/h1,6-12H,13H2,2-4H3,(H,23,29)(H,24,28) |
| InChIKey | OCCFTGXCKPEXMX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|