C18H21N7O — CID 55647317
2-(2,4-dimethylphenyl)-5-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]triazole-4-carboxamide (PubChem CID 55647317) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-5-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]triazole-4-carboxamide.
| Compound Name | 2-(2,4-dimethylphenyl)-5-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 55647317 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-5-methyl-N-[2-(pyrimidin-2-ylamino)ethyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(-n2nc(C)c(C(=O)NCCNc3ncccn3)n2)c(C)c1 |
| InChI | InChI=1S/C18H21N7O/c1-12-5-6-15(13(2)11-12)25-23-14(3)16(24-25)17(26)19-9-10-22-18-20-7-4-8-21-18/h4-8,11H,9-10H2,1-3H3,(H,19,26)(H,20,21,22) |
| InChIKey | VGJYZFPTKABUBC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|