C19H17ClN2O3 — CID 51962961
(2R)-2-(2-chlorophenoxy)-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide (PubChem CID 51962961) has the molecular formula C19H17ClN2O3 and a molecular weight of 356.81 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenoxy)-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide.
| Compound Name | (2R)-2-(2-chlorophenoxy)-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 51962961 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | (2R)-2-(2-chlorophenoxy)-N-[2-(3-ethynylanilino)-2-oxoethyl]propanamide |
| SMILES | C#Cc1cccc(NC(=O)CNC(=O)[C@@H](C)Oc2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O3/c1-3-14-7-6-8-15(11-14)22-18(23)12-21-19(24)13(2)25-17-10-5-4-9-16(17)20/h1,4-11,13H,12H2,2H3,(H,21,24)(H,22,23)/t13-/m1/s1 |
| InChIKey | ZZXQDGNOCIUAGV-CYBMUJFWSA-N |
| XLogP | 2.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|