C21H24N4O — CID 111342471
N-(3-ethynylphenyl)-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]acetamide (PubChem CID 111342471) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-(3-ethynylphenyl)-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111342471 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-(3-ethynylphenyl)-2-[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]acetamide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N/C)NCC(C)c2ccccc2)c1 |
| InChI | InChI=1S/C21H24N4O/c1-4-17-9-8-12-19(13-17)25-20(26)15-24-21(22-3)23-14-16(2)18-10-6-5-7-11-18/h1,5-13,16H,14-15H2,2-3H3,(H,25,26)(H2,22,23,24) |
| InChIKey | HCZYRMCLKXTXHX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|