C19H19FN4O — CID 111876497
N-(3-ethynylphenyl)-2-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111876497) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-(3-ethynylphenyl)-2-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111876497 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-(3-ethynylphenyl)-2-[[N-[(3-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N/C)NCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H19FN4O/c1-3-14-6-5-9-17(11-14)24-18(25)13-23-19(21-2)22-12-15-7-4-8-16(20)10-15/h1,4-11H,12-13H2,2H3,(H,24,25)(H2,21,22,23) |
| InChIKey | ORXNQJBTGHTRCJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|