C20H22FIN4O — CID 111361612
N-(3-ethynylphenyl)-2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111361612) has the molecular formula C20H22FIN4O and a molecular weight of 480.33 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(3-ethynylphenyl)-2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111361612 |
| Molecular Formula | C20H22FIN4O |
| Molecular Weight | 480.33 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | N-(3-ethynylphenyl)-2-[[N-[2-(2-fluorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N/C)NCCc2ccccc2F)c1.I |
| InChI | InChI=1S/C20H21FN4O.HI/c1-3-15-7-6-9-17(13-15)25-19(26)14-24-20(22-2)23-12-11-16-8-4-5-10-18(16)21;/h1,4-10,13H,11-12,14H2,2H3,(H,25,26)(H2,22,23,24);1H |
| InChIKey | MSQPOQQTXIDRGN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|