C20H21ClN4O — CID 111357804
2-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide (PubChem CID 111357804) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 2-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide.
| Compound Name | 2-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide |
|---|---|
| PubChem CID | 111357804 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[[N-[2-(3-chlorophenyl)ethyl]-N'-methylcarbamimidoyl]amino]-N-(3-ethynylphenyl)acetamide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N/C)NCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C20H21ClN4O/c1-3-15-6-5-9-18(13-15)25-19(26)14-24-20(22-2)23-11-10-16-7-4-8-17(21)12-16/h1,4-9,12-13H,10-11,14H2,2H3,(H,25,26)(H2,22,23,24) |
| InChIKey | JYKNMQVMCZWWBV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|