C20H30IN5O3 — CID 111886300
tert-butyl N-[3-[[N-[2-(3-ethynylanilino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide (PubChem CID 111886300) has the molecular formula C20H30IN5O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-[2-(3-ethynylanilino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[N-[2-(3-ethynylanilino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111886300 |
| Molecular Formula | C20H30IN5O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 515.14 |
| IUPAC Name | tert-butyl N-[3-[[N-[2-(3-ethynylanilino)-2-oxoethyl]-N'-methylcarbamimidoyl]amino]propyl]carbamate;hydroiodide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N/C)NCCCNC(=O)OC(C)(C)C)c1.I |
| InChI | InChI=1S/C20H29N5O3.HI/c1-6-15-9-7-10-16(13-15)25-17(26)14-24-18(21-5)22-11-8-12-23-19(27)28-20(2,3)4;/h1,7,9-10,13H,8,11-12,14H2,2-5H3,(H,23,27)(H,25,26)(H2,21,22,24);1H |
| InChIKey | HSOLZOLAGSVHAS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 103.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|