C23H26N6O — CID 111351940
N-(3-ethynylphenyl)-2-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]acetamide (PubChem CID 111351940) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is N-(3-ethynylphenyl)-2-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-(3-ethynylphenyl)-2-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111351940 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-(3-ethynylphenyl)-2-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]acetamide |
| SMILES | C#Cc1cccc(NC(=O)CN/C(=N\C)NCCCn2c(C)nc3ccccc32)c1 |
| InChI | InChI=1S/C23H26N6O/c1-4-18-9-7-10-19(15-18)28-22(30)16-26-23(24-3)25-13-8-14-29-17(2)27-20-11-5-6-12-21(20)29/h1,5-7,9-12,15H,8,13-14,16H2,2-3H3,(H,28,30)(H2,24,25,26) |
| InChIKey | MTOOBWIUZURELT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|