C22H30N6O2 — CID 111775552
3-methyl-N-[3-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]propyl]furan-2-carboxamide (PubChem CID 111775552) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-methyl-N-[3-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]propyl]furan-2-carboxamide.
| Compound Name | 3-methyl-N-[3-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111775552 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 3-methyl-N-[3-[[N'-methyl-N-[3-(2-methylbenzimidazol-1-yl)propyl]carbamimidoyl]amino]propyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCCCNC(=O)c1occc1C)NCCCn1c(C)nc2ccccc21 |
| InChI | InChI=1S/C22H30N6O2/c1-16-10-15-30-20(16)21(29)24-11-6-12-25-22(23-3)26-13-7-14-28-17(2)27-18-8-4-5-9-19(18)28/h4-5,8-10,15H,6-7,11-14H2,1-3H3,(H,24,29)(H2,23,25,26) |
| InChIKey | SWVLVUZDBZXHJB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|