C12H9ClIN3OS — CID 2983334
5-chloro-N-(3-iodophenyl)-2-methylsulfanylpyrimidine-4-carboxamide (PubChem CID 2983334) has the molecular formula C12H9ClIN3OS and a molecular weight of 405.65 g/mol. Its IUPAC name is 5-chloro-N-(3-iodophenyl)-2-methylsulfanylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-(3-iodophenyl)-2-methylsulfanylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 2983334 |
| Molecular Formula | C12H9ClIN3OS |
| Molecular Weight | 405.65 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | 5-chloro-N-(3-iodophenyl)-2-methylsulfanylpyrimidine-4-carboxamide |
| SMILES | CSc1ncc(Cl)c(C(=O)Nc2cccc(I)c2)n1 |
| InChI | InChI=1S/C12H9ClIN3OS/c1-19-12-15-6-9(13)10(17-12)11(18)16-8-4-2-3-7(14)5-8/h2-6H,1H3,(H,16,18) |
| InChIKey | SUGRSRRCNCQJOQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.65 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|